C12H15Cl2NO4 — CID 175407279
[1-(2,6-dichlorophenyl)-1-(methoxymethoxy)propyl] carbamate (PubChem CID 175407279) has the molecular formula C12H15Cl2NO4 and a molecular weight of 308.16 g/mol. Its IUPAC name is [1-(2,6-dichlorophenyl)-1-(methoxymethoxy)propyl] carbamate.
| Compound Name | [1-(2,6-dichlorophenyl)-1-(methoxymethoxy)propyl] carbamate |
|---|---|
| PubChem CID | 175407279 |
| Molecular Formula | C12H15Cl2NO4 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | [1-(2,6-dichlorophenyl)-1-(methoxymethoxy)propyl] carbamate |
| SMILES | CCC(OCOC)(OC(N)=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO4/c1-3-12(18-7-17-2,19-11(15)16)10-8(13)5-4-6-9(10)14/h4-6H,3,7H2,1-2H3,(H2,15,16) |
| InChIKey | SOOZFFYBXYOOKD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|