C16H38N3O3P — CID 175408582
N-[2-[amino-[2-[di(propan-2-yl)amino]ethoxy]phosphoryl]oxyethyl]-N-propan-2-ylpropan-2-amine (PubChem CID 175408582) has the molecular formula C16H38N3O3P and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[2-[amino-[2-[di(propan-2-yl)amino]ethoxy]phosphoryl]oxyethyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[2-[amino-[2-[di(propan-2-yl)amino]ethoxy]phosphoryl]oxyethyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 175408582 |
| Molecular Formula | C16H38N3O3P |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | N-[2-[amino-[2-[di(propan-2-yl)amino]ethoxy]phosphoryl]oxyethyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(CCOP(N)(=O)OCCN(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H38N3O3P/c1-13(2)18(14(3)4)9-11-21-23(17,20)22-12-10-19(15(5)6)16(7)8/h13-16H,9-12H2,1-8H3,(H2,17,20) |
| InChIKey | CVIPQQRLPCVBFZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|