C6H12Cl4NO3P — CID 139367377
3-[amino(3,3-dichloropropoxy)phosphoryl]oxy-1,1-dichloropropane (PubChem CID 139367377) has the molecular formula C6H12Cl4NO3P and a molecular weight of 318.95 g/mol. Its IUPAC name is 3-[amino(3,3-dichloropropoxy)phosphoryl]oxy-1,1-dichloropropane.
| Compound Name | 3-[amino(3,3-dichloropropoxy)phosphoryl]oxy-1,1-dichloropropane |
|---|---|
| PubChem CID | 139367377 |
| Molecular Formula | C6H12Cl4NO3P |
| Molecular Weight | 318.95 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 3-[amino(3,3-dichloropropoxy)phosphoryl]oxy-1,1-dichloropropane |
| SMILES | NP(=O)(OCCC(Cl)Cl)OCCC(Cl)Cl |
| InChI | InChI=1S/C6H12Cl4NO3P/c7-5(8)1-3-13-15(11,12)14-4-2-6(9)10/h5-6H,1-4H2,(H2,11,12) |
| InChIKey | URRODVHNLWJJJR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|