C6H10Cl5O3P — CID 142627107
1,1-dichloro-3-[chloro(3,3-dichloropropoxy)phosphoryl]oxypropane (PubChem CID 142627107) has the molecular formula C6H10Cl5O3P and a molecular weight of 338.38 g/mol. Its IUPAC name is 1,1-dichloro-3-[chloro(3,3-dichloropropoxy)phosphoryl]oxypropane.
| Compound Name | 1,1-dichloro-3-[chloro(3,3-dichloropropoxy)phosphoryl]oxypropane |
|---|---|
| PubChem CID | 142627107 |
| Molecular Formula | C6H10Cl5O3P |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 335.88 |
| IUPAC Name | 1,1-dichloro-3-[chloro(3,3-dichloropropoxy)phosphoryl]oxypropane |
| SMILES | O=P(Cl)(OCCC(Cl)Cl)OCCC(Cl)Cl |
| InChI | InChI=1S/C6H10Cl5O3P/c7-5(8)1-3-13-15(11,12)14-4-2-6(9)10/h5-6H,1-4H2 |
| InChIKey | SJGBZVIREMIXKX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|