C18H39O3P — CID 57284798
3,5,5-trimethylhexoxy(3,5,5-trimethylhexyl)phosphinic acid (PubChem CID 57284798) has the molecular formula C18H39O3P and a molecular weight of 334.48 g/mol. Its IUPAC name is 3,5,5-trimethylhexoxy(3,5,5-trimethylhexyl)phosphinic acid.
| Compound Name | 3,5,5-trimethylhexoxy(3,5,5-trimethylhexyl)phosphinic acid |
|---|---|
| PubChem CID | 57284798 |
| Molecular Formula | C18H39O3P |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 3,5,5-trimethylhexoxy(3,5,5-trimethylhexyl)phosphinic acid |
| SMILES | CC(CCOP(=O)(O)CCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H39O3P/c1-15(13-17(3,4)5)9-11-21-22(19,20)12-10-16(2)14-18(6,7)8/h15-16H,9-14H2,1-8H3,(H,19,20) |
| InChIKey | MDBAYLHAMIKGSV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|