C17H24F10O — CID 175415315
1,1,1,7,7,9,9,15,15,15-decafluoro-6,10-dimethylpentadecan-8-one (PubChem CID 175415315) has the molecular formula C17H24F10O and a molecular weight of 434.36 g/mol. Its IUPAC name is 1,1,1,7,7,9,9,15,15,15-decafluoro-6,10-dimethylpentadecan-8-one.
| Compound Name | 1,1,1,7,7,9,9,15,15,15-decafluoro-6,10-dimethylpentadecan-8-one |
|---|---|
| PubChem CID | 175415315 |
| Molecular Formula | C17H24F10O |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1,1,1,7,7,9,9,15,15,15-decafluoro-6,10-dimethylpentadecan-8-one |
| SMILES | CC(CCCCC(F)(F)F)C(F)(F)C(=O)C(F)(F)C(C)CCCCC(F)(F)F |
| InChI | InChI=1S/C17H24F10O/c1-11(7-3-5-9-14(18,19)20)16(24,25)13(28)17(26,27)12(2)8-4-6-10-15(21,22)23/h11-12H,3-10H2,1-2H3 |
| InChIKey | NXCSGPNJLAUTIB-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|