C8H4N5+ — CID 175416365
2,4-dicyano-1-(diazonioamino)benzene (PubChem CID 175416365) has the molecular formula C8H4N5+ and a molecular weight of 170.15 g/mol. Its IUPAC name is 2,4-dicyano-1-(diazonioamino)benzene.
| Compound Name | 2,4-dicyano-1-(diazonioamino)benzene |
|---|---|
| PubChem CID | 175416365 |
| Molecular Formula | C8H4N5+ |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2,4-dicyano-1-(diazonioamino)benzene |
| SMILES | N#Cc1ccc(N[N+]#N)c(C#N)c1 |
| InChI | InChI=1S/C8H4N5/c9-4-6-1-2-8(12-13-11)7(3-6)5-10/h1-3,12H/q+1 |
| InChIKey | SPKINQRAVJWHCJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|