C13H9BrIN3O2S — CID 175416588
2-bromo-7-iodo-3-(3-methylphenyl)sulfonyl-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 175416588) has the molecular formula C13H9BrIN3O2S and a molecular weight of 478.11 g/mol. Its IUPAC name is 2-bromo-7-iodo-3-(3-methylphenyl)sulfonyl-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 2-bromo-7-iodo-3-(3-methylphenyl)sulfonyl-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 175416588 |
| Molecular Formula | C13H9BrIN3O2S |
| Molecular Weight | 478.11 g/mol |
| Exact Mass | 476.86 |
| IUPAC Name | 2-bromo-7-iodo-3-(3-methylphenyl)sulfonyl-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | Cc1cccc(S(=O)(=O)c2nc3[nH]cc(I)c3nc2Br)c1 |
| InChI | InChI=1S/C13H9BrIN3O2S/c1-7-3-2-4-8(5-7)21(19,20)13-11(14)17-10-9(15)6-16-12(10)18-13/h2-6H,1H3,(H,16,18) |
| InChIKey | MNFSDKUUOXJOPV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|