C16H31NO2S — CID 175420241
(2S)-2-(2-methylsulfanylethyl)-2-[pentyl(prop-2-enyl)amino]pentanoic acid (PubChem CID 175420241) has the molecular formula C16H31NO2S and a molecular weight of 301.50 g/mol. Its IUPAC name is (2S)-2-(2-methylsulfanylethyl)-2-[pentyl(prop-2-enyl)amino]pentanoic acid.
| Compound Name | (2S)-2-(2-methylsulfanylethyl)-2-[pentyl(prop-2-enyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 175420241 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | (2S)-2-(2-methylsulfanylethyl)-2-[pentyl(prop-2-enyl)amino]pentanoic acid |
| SMILES | C=CCN(CCCCC)[C@@](CCC)(CCSC)C(=O)O |
| InChI | InChI=1S/C16H31NO2S/c1-5-8-9-13-17(12-7-3)16(10-6-2,15(18)19)11-14-20-4/h7H,3,5-6,8-14H2,1-2,4H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | CZSRRSIEMRKVQS-INIZCTEOSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|