C17H34Br2N2 — CID 141468529
2-N,2-N-dibromo-2,3-dimethyl-3-N-octyl-3-N-prop-2-enylbutane-2,3-diamine (PubChem CID 141468529) has the molecular formula C17H34Br2N2 and a molecular weight of 426.28 g/mol. Its IUPAC name is 2-N,2-N-dibromo-2,3-dimethyl-3-N-octyl-3-N-prop-2-enylbutane-2,3-diamine.
| Compound Name | 2-N,2-N-dibromo-2,3-dimethyl-3-N-octyl-3-N-prop-2-enylbutane-2,3-diamine |
|---|---|
| PubChem CID | 141468529 |
| Molecular Formula | C17H34Br2N2 |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-N,2-N-dibromo-2,3-dimethyl-3-N-octyl-3-N-prop-2-enylbutane-2,3-diamine |
| SMILES | C=CCN(CCCCCCCC)C(C)(C)C(C)(C)N(Br)Br |
| InChI | InChI=1S/C17H34Br2N2/c1-7-9-10-11-12-13-15-20(14-8-2)16(3,4)17(5,6)21(18)19/h8H,2,7,9-15H2,1,3-6H3 |
| InChIKey | PTZYRNQSDZWQER-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|