2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid

C7H13NO4 — CID 87917847

IUPAC2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid
SMILESC=CCN(CC)C(O)(O)C(=O)O
InChIInChI=1S/C7H13NO4/c1-3-5-8(4-2)7(11,12)6(9)10/h3,11-12H,1,4-5H2,2H3,(H,9,10)
InChIKeyRLWQASXGHOOTOT-UHFFFAOYSA-N
MW175.18 g/mol
LogP-0.78
Rot. Bonds5

About 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid

2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid (PubChem CID 87917847) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid.

Molecular Properties

Compound Name2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid
PubChem CID87917847
Molecular FormulaC7H13NO4
Molecular Weight175.18 g/mol
Exact Mass175.08
IUPAC Name2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid
SMILESC=CCN(CC)C(O)(O)C(=O)O
InChIInChI=1S/C7H13NO4/c1-3-5-8(4-2)7(11,12)6(9)10/h3,11-12H,1,4-5H2,2H3,(H,9,10)
InChIKeyRLWQASXGHOOTOT-UHFFFAOYSA-N
XLogP-0.78
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.18
LogP ≤ 5-0.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid?
The IUPAC name of 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid (CID 87917847) is 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid.
What is the SMILES notation for 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid?
The canonical SMILES for 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid is C=CCN(CC)C(O)(O)C(=O)O.
What is the InChIKey of 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid?
The InChIKey is RLWQASXGHOOTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-3-5-8(4-2)7(11,12)6(9)10/h3,11-12H,1,4-5H2,2H3,(H,9,10).
What are the key properties of 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid?
2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid has a molecular weight of 175.18 g/mol, XLogP of -0.78, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(prop-2-enyl)amino]-2,2-dihydroxyacetic acid is sourced from PubChem (CID 87917847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).