C11H18N2O — CID 87932412
N-ethyl-N',N'-bis(prop-2-enyl)prop-2-enehydrazide (PubChem CID 87932412) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-ethyl-N',N'-bis(prop-2-enyl)prop-2-enehydrazide.
| Compound Name | N-ethyl-N',N'-bis(prop-2-enyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 87932412 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-ethyl-N',N'-bis(prop-2-enyl)prop-2-enehydrazide |
| SMILES | C=CCN(CC=C)N(CC)C(=O)C=C |
| InChI | InChI=1S/C11H18N2O/c1-5-9-12(10-6-2)13(8-4)11(14)7-3/h5-7H,1-3,8-10H2,4H3 |
| InChIKey | XAQSVMKBGXCVMR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|