C12H24N2O — CID 87503910
N,N',N'-tripropylprop-2-enehydrazide (PubChem CID 87503910) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N,N',N'-tripropylprop-2-enehydrazide.
| Compound Name | N,N',N'-tripropylprop-2-enehydrazide |
|---|---|
| PubChem CID | 87503910 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N,N',N'-tripropylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CCC)N(CCC)CCC |
| InChI | InChI=1S/C12H24N2O/c1-5-9-13(10-6-2)14(11-7-3)12(15)8-4/h8H,4-7,9-11H2,1-3H3 |
| InChIKey | NFHUGYAMMCANPO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|