C10H18N2O — CID 19835655
N-methyl-N',N'-bis(prop-2-enyl)propanehydrazide (PubChem CID 19835655) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-methyl-N',N'-bis(prop-2-enyl)propanehydrazide.
| Compound Name | N-methyl-N',N'-bis(prop-2-enyl)propanehydrazide |
|---|---|
| PubChem CID | 19835655 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-methyl-N',N'-bis(prop-2-enyl)propanehydrazide |
| SMILES | C=CCN(CC=C)N(C)C(=O)CC |
| InChI | InChI=1S/C10H18N2O/c1-5-8-12(9-6-2)11(4)10(13)7-3/h5-6H,1-2,7-9H2,3-4H3 |
| InChIKey | SCBGDAUVIQZLSH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|