About N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide
N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide (PubChem CID 18711197) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide.
Molecular Properties
| Compound Name | N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide |
| PubChem CID | 18711197 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide |
| SMILES | CC/C=C/N(C)N(C)C(=O)CC |
| InChI | InChI=1S/C9H18N2O/c1-5-7-8-10(3)11(4)9(12)6-2/h7-8H,5-6H2,1-4H3/b8-7+ |
| InChIKey | AWNURRMBPQDHJP-BQYQJAHWSA-N |
| XLogP | 1.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide?
The IUPAC name of N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide (CID 18711197) is N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide.
What is the SMILES notation for N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide?
The canonical SMILES for N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide is CC/C=C/N(C)N(C)C(=O)CC.
What is the InChIKey of N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide?
The InChIKey is AWNURRMBPQDHJP-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H18N2O/c1-5-7-8-10(3)11(4)9(12)6-2/h7-8H,5-6H2,1-4H3/b8-7+.
What are the key properties of N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide?
N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide has a molecular weight of 170.26 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-but-1-enyl]-N,N'-dimethylpropanehydrazide is sourced from PubChem (CID 18711197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).