C11H20O4Si — CID 175422367
1,2-bis(prop-1-en-2-yloxy)ethenol;prop-1-en-2-yloxysilane (PubChem CID 175422367) has the molecular formula C11H20O4Si and a molecular weight of 244.36 g/mol. Its IUPAC name is 1,2-bis(prop-1-en-2-yloxy)ethenol;prop-1-en-2-yloxysilane.
| Compound Name | 1,2-bis(prop-1-en-2-yloxy)ethenol;prop-1-en-2-yloxysilane |
|---|---|
| PubChem CID | 175422367 |
| Molecular Formula | C11H20O4Si |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1,2-bis(prop-1-en-2-yloxy)ethenol;prop-1-en-2-yloxysilane |
| SMILES | C=C(C)OC=C(O)OC(=C)C.C=C(C)O[SiH3] |
| InChI | InChI=1S/C8H12O3.C3H8OSi/c1-6(2)10-5-8(9)11-7(3)4;1-3(2)4-5/h5,9H,1,3H2,2,4H3;1H2,2,5H3 |
| InChIKey | SVOILMCKBPUHGW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|