C7H5BrF3NO — CID 175422672
2-bromo-5-(1,2,2-trifluoroethoxy)pyridine (PubChem CID 175422672) has the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. Its IUPAC name is 2-bromo-5-(1,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-bromo-5-(1,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 175422672 |
| Molecular Formula | C7H5BrF3NO |
| Molecular Weight | 256.02 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 2-bromo-5-(1,2,2-trifluoroethoxy)pyridine |
| SMILES | FC(F)C(F)Oc1ccc(Br)nc1 |
| InChI | InChI=1S/C7H5BrF3NO/c8-5-2-1-4(3-12-5)13-7(11)6(9)10/h1-3,6-7H |
| InChIKey | LJEABNFUUPQKOA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.02 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|