C27H34ClN3O3 — CID 175423116
3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]octyl prop-2-enoate (PubChem CID 175423116) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]octyl prop-2-enoate.
| Compound Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]octyl prop-2-enoate |
|---|---|
| PubChem CID | 175423116 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(CCCCC)c1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H34ClN3O3/c1-6-8-9-10-18(13-14-34-25(32)7-2)19-15-21(27(3,4)5)26(33)24(16-19)31-29-22-12-11-20(28)17-23(22)30-31/h7,11-12,15-18,33H,2,6,8-10,13-14H2,1,3-5H3 |
| InChIKey | FMSLWIZQWAXBKJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|