C30H36ClN3O2 — CID 151722818
2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(2-octoxyphenyl)phenol (PubChem CID 151722818) has the molecular formula C30H36ClN3O2 and a molecular weight of 506.09 g/mol. Its IUPAC name is 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(2-octoxyphenyl)phenol.
| Compound Name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(2-octoxyphenyl)phenol |
|---|---|
| PubChem CID | 151722818 |
| Molecular Formula | C30H36ClN3O2 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(2-octoxyphenyl)phenol |
| SMILES | CCCCCCCCOc1ccccc1-c1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H36ClN3O2/c1-5-6-7-8-9-12-17-36-28-14-11-10-13-23(28)21-18-24(30(2,3)4)29(35)27(19-21)34-32-25-16-15-22(31)20-26(25)33-34/h10-11,13-16,18-20,35H,5-9,12,17H2,1-4H3 |
| InChIKey | RIYCAHODXXUEMO-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|