C26H34ClN3O3 — CID 22610335
octan-2-yl 2-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]acetate (PubChem CID 22610335) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is octan-2-yl 2-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]acetate.
| Compound Name | octan-2-yl 2-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 22610335 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | octan-2-yl 2-[3-tert-butyl-5-(5-chlorobenzotriazol-2-yl)-4-hydroxyphenyl]acetate |
| SMILES | CCCCCCC(C)OC(=O)Cc1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34ClN3O3/c1-6-7-8-9-10-17(2)33-24(31)15-18-13-20(26(3,4)5)25(32)23(14-18)30-28-21-12-11-19(27)16-22(21)29-30/h11-14,16-17,32H,6-10,15H2,1-5H3 |
| InChIKey | LMPCWVLYWVKZQO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|