C23H27F5N4O5S — CID 175424964
tert-butyl-[(2R,3S,5R,6S)-5-deuterio-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)oxan-3-yl]carbamic acid (PubChem CID 175424964) has the molecular formula C23H27F5N4O5S and a molecular weight of 567.56 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5R,6S)-5-deuterio-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)oxan-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R,3S,5R,6S)-5-deuterio-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175424964 |
| Molecular Formula | C23H27F5N4O5S |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | tert-butyl-[(2R,3S,5R,6S)-5-deuterio-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)oxan-3-yl]carbamic acid |
| SMILES | [2H][C@@]1(N2Cc3cn(S(C)(=O)=O)nc3C2)C[C@H](N(C(=O)O)C(C)(C)C)[C@@H](c2cc(F)ccc2F)O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C23H27F5N4O5S/c1-22(2,3)32(21(33)34)17-8-18(30-9-12-10-31(38(4,35)36)29-16(12)11-30)20(23(26,27)28)37-19(17)14-7-13(24)5-6-15(14)25/h5-7,10,17-20H,8-9,11H2,1-4H3,(H,33,34)/t17-,18+,19+,20-/m0/s1/i18D |
| InChIKey | DPZIAHZIMMYRMY-FKGYVEAZSA-N |
| XLogP | 3.89 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |