C19H22F2N4O2S — CID 72725146
(1R,2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)bicyclo[4.1.0]heptan-3-amine (PubChem CID 72725146) has the molecular formula C19H22F2N4O2S and a molecular weight of 408.47 g/mol. Its IUPAC name is (1R,2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)bicyclo[4.1.0]heptan-3-amine.
| Compound Name | (1R,2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)bicyclo[4.1.0]heptan-3-amine |
|---|---|
| PubChem CID | 72725146 |
| Molecular Formula | C19H22F2N4O2S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (1R,2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)bicyclo[4.1.0]heptan-3-amine |
| SMILES | CS(=O)(=O)n1cc2c(n1)CN([C@@H]1C[C@H](N)[C@@H](c3cc(F)ccc3F)[C@@H]3C[C@@H]31)C2 |
| InChI | InChI=1S/C19H22F2N4O2S/c1-28(26,27)25-8-10-7-24(9-17(10)23-25)18-6-16(22)19(13-5-12(13)18)14-4-11(20)2-3-15(14)21/h2-4,8,12-13,16,18-19H,5-7,9,22H2,1H3/t12-,13+,16-,18+,19+/m0/s1 |
| InChIKey | NORORCDJGLSGLA-PQYPPTLTSA-N |
| XLogP | 1.80 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |