C27H30N9O3S- — CID 175425785
CID 175425785 (PubChem CID 175425785) has the molecular formula C27H30N9O3S- and a molecular weight of 560.66 g/mol.
| Compound Name | CID 175425785 |
|---|---|
| PubChem CID | 175425785 |
| Molecular Formula | C27H30N9O3S- |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1Nc1nc(Nc2ccc(N3CCOCC3)cc2)nc2[nH]cc(-c3cn[nH]c3)c12.NS(=O)[O-] |
| InChI | InChI=1S/C27H28N8O.H3NO2S/c1-17-4-3-5-18(2)24(17)32-26-23-22(19-14-29-30-15-19)16-28-25(23)33-27(34-26)31-20-6-8-21(9-7-20)35-10-12-36-13-11-35;1-4(2)3/h3-9,14-16H,10-13H2,1-2H3,(H,29,30)(H3,28,31,32,33,34);1H2,(H,2,3)/p-1 |
| InChIKey | LWMBTDWRPURGHE-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 172.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|