C28H26N6O2 — CID 155538122
5-(4-aminophenyl)-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 155538122) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-(4-aminophenyl)-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155538122 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 5-(4-aminophenyl)-N-(4-morpholin-4-ylphenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1ccc(-c2c[nH]c3nc(Nc4ccc(N5CCOCC5)cc4)nc(Oc4ccccc4)c23)cc1 |
| InChI | InChI=1S/C28H26N6O2/c29-20-8-6-19(7-9-20)24-18-30-26-25(24)27(36-23-4-2-1-3-5-23)33-28(32-26)31-21-10-12-22(13-11-21)34-14-16-35-17-15-34/h1-13,18H,14-17,29H2,(H2,30,31,32,33) |
| InChIKey | TYJKWQLFIQQBAF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|