C20H33O2P — CID 175426900
butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid (PubChem CID 175426900) has the molecular formula C20H33O2P and a molecular weight of 336.46 g/mol. Its IUPAC name is butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid.
| Compound Name | butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid |
|---|---|
| PubChem CID | 175426900 |
| Molecular Formula | C20H33O2P |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid |
| SMILES | CCCCC(=Cc1ccc(P(=O)(O)CCCC)cc1)CCCC |
| InChI | InChI=1S/C20H33O2P/c1-4-7-10-18(11-8-5-2)17-19-12-14-20(15-13-19)23(21,22)16-9-6-3/h12-15,17H,4-11,16H2,1-3H3,(H,21,22) |
| InChIKey | ORXALFPBIFQSOO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|