butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid

C20H33O2P — CID 175426900

IUPACbutyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid
SMILESCCCCC(=Cc1ccc(P(=O)(O)CCCC)cc1)CCCC
InChIInChI=1S/C20H33O2P/c1-4-7-10-18(11-8-5-2)17-19-12-14-20(15-13-19)23(21,22)16-9-6-3/h12-15,17H,4-11,16H2,1-3H3,(H,21,22)
InChIKeyORXALFPBIFQSOO-UHFFFAOYSA-N
MW336.46 g/mol
LogP6.15
Rot. Bonds11

About butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid

butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid (PubChem CID 175426900) has the molecular formula C20H33O2P and a molecular weight of 336.46 g/mol. Its IUPAC name is butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid.

Molecular Properties

Compound Namebutyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid
PubChem CID175426900
Molecular FormulaC20H33O2P
Molecular Weight336.46 g/mol
Exact Mass336.22
IUPAC Namebutyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid
SMILESCCCCC(=Cc1ccc(P(=O)(O)CCCC)cc1)CCCC
InChIInChI=1S/C20H33O2P/c1-4-7-10-18(11-8-5-2)17-19-12-14-20(15-13-19)23(21,22)16-9-6-3/h12-15,17H,4-11,16H2,1-3H3,(H,21,22)
InChIKeyORXALFPBIFQSOO-UHFFFAOYSA-N
XLogP6.15
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds11
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500336.46
LogP ≤ 56.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid?
The IUPAC name of butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid (CID 175426900) is butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid.
What is the SMILES notation for butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid?
The canonical SMILES for butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid is CCCCC(=Cc1ccc(P(=O)(O)CCCC)cc1)CCCC.
What is the InChIKey of butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid?
The InChIKey is ORXALFPBIFQSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33O2P/c1-4-7-10-18(11-8-5-2)17-19-12-14-20(15-13-19)23(21,22)16-9-6-3/h12-15,17H,4-11,16H2,1-3H3,(H,21,22).
What are the key properties of butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid?
butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid has a molecular weight of 336.46 g/mol, XLogP of 6.15, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[4-(2-butylhex-1-enyl)phenyl]phosphinic acid is sourced from PubChem (CID 175426900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).