About sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride
sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride (PubChem CID 175427051) has the molecular formula C16H34NNaO2
and a molecular weight of 295.44 g/mol. Its IUPAC name is sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride.
Molecular Properties
| Compound Name | sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride |
| PubChem CID | 175427051 |
| Molecular Formula | C16H34NNaO2 |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride |
| SMILES | CCCCCCCCCCCCOC(=O)[C@H](C)NC.[H-].[Na+] |
| InChI | InChI=1S/C16H33NO2.Na.H/c1-4-5-6-7-8-9-10-11-12-13-14-19-16(18)15(2)17-3;;/h15,17H,4-14H2,1-3H3;;/q;+1;-1/t15-;;/m0../s1 |
| InChIKey | FPBRWZNOHFZXMH-CKUXDGONSA-N |
| XLogP | 1.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride?
The IUPAC name of sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride (CID 175427051) is sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride.
What is the SMILES notation for sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride?
The canonical SMILES for sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride is CCCCCCCCCCCCOC(=O)[C@H](C)NC.[H-].[Na+].
What is the InChIKey of sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride?
The InChIKey is FPBRWZNOHFZXMH-CKUXDGONSA-N. The full InChI is InChI=1S/C16H33NO2.Na.H/c1-4-5-6-7-8-9-10-11-12-13-14-19-16(18)15(2)17-3;;/h15,17H,4-14H2,1-3H3;;/q;+1;-1/t15-;;/m0../s1.
What are the key properties of sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride?
sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride has a molecular weight of 295.44 g/mol, XLogP of 1.17, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dodecyl (2S)-2-(methylamino)propanoate;hydride is sourced from PubChem (CID 175427051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).