About O-undecan-2-yl sulfamoylmethanethioate
O-undecan-2-yl sulfamoylmethanethioate (PubChem CID 175429570) has the molecular formula C12H25NO3S2
and a molecular weight of 295.47 g/mol. Its IUPAC name is O-undecan-2-yl sulfamoylmethanethioate.
Molecular Properties
| Compound Name | O-undecan-2-yl sulfamoylmethanethioate |
| PubChem CID | 175429570 |
| Molecular Formula | C12H25NO3S2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | O-undecan-2-yl sulfamoylmethanethioate |
| SMILES | CCCCCCCCCC(C)OC(=S)S(N)(=O)=O |
| InChI | InChI=1S/C12H25NO3S2/c1-3-4-5-6-7-8-9-10-11(2)16-12(17)18(13,14)15/h11H,3-10H2,1-2H3,(H2,13,14,15) |
| InChIKey | PHGCDGFVYKTTMX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-undecan-2-yl sulfamoylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-undecan-2-yl sulfamoylmethanethioate?
The IUPAC name of O-undecan-2-yl sulfamoylmethanethioate (CID 175429570) is O-undecan-2-yl sulfamoylmethanethioate.
What is the SMILES notation for O-undecan-2-yl sulfamoylmethanethioate?
The canonical SMILES for O-undecan-2-yl sulfamoylmethanethioate is CCCCCCCCCC(C)OC(=S)S(N)(=O)=O.
What is the InChIKey of O-undecan-2-yl sulfamoylmethanethioate?
The InChIKey is PHGCDGFVYKTTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3S2/c1-3-4-5-6-7-8-9-10-11(2)16-12(17)18(13,14)15/h11H,3-10H2,1-2H3,(H2,13,14,15).
What are the key properties of O-undecan-2-yl sulfamoylmethanethioate?
O-undecan-2-yl sulfamoylmethanethioate has a molecular weight of 295.47 g/mol, XLogP of 3.11, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-undecan-2-yl sulfamoylmethanethioate is sourced from PubChem (CID 175429570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).