C12H24N2O4 — CID 175431718
3-acetyl-2-methyl-4-oxopentanoic acid;butane-1,4-diamine (PubChem CID 175431718) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-acetyl-2-methyl-4-oxopentanoic acid;butane-1,4-diamine.
| Compound Name | 3-acetyl-2-methyl-4-oxopentanoic acid;butane-1,4-diamine |
|---|---|
| PubChem CID | 175431718 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-acetyl-2-methyl-4-oxopentanoic acid;butane-1,4-diamine |
| SMILES | CC(=O)C(C(C)=O)C(C)C(=O)O.NCCCCN |
| InChI | InChI=1S/C8H12O4.C4H12N2/c1-4(8(11)12)7(5(2)9)6(3)10;5-3-1-2-4-6/h4,7H,1-3H3,(H,11,12);1-6H2 |
| InChIKey | HJJDBZJAMPISNT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|