C18H18ClNO5 — CID 175432112
6-[6-(2-chloro-5-methoxyphenyl)-3-hydroxy-2-pyridinyl]-4-oxohexanoic acid (PubChem CID 175432112) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 6-[6-(2-chloro-5-methoxyphenyl)-3-hydroxy-2-pyridinyl]-4-oxohexanoic acid.
| Compound Name | 6-[6-(2-chloro-5-methoxyphenyl)-3-hydroxy-2-pyridinyl]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 175432112 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-[6-(2-chloro-5-methoxyphenyl)-3-hydroxy-2-pyridinyl]-4-oxohexanoic acid |
| SMILES | COc1ccc(Cl)c(-c2ccc(O)c(CCC(=O)CCC(=O)O)n2)c1 |
| InChI | InChI=1S/C18H18ClNO5/c1-25-12-4-5-14(19)13(10-12)15-7-8-17(22)16(20-15)6-2-11(21)3-9-18(23)24/h4-5,7-8,10,22H,2-3,6,9H2,1H3,(H,23,24) |
| InChIKey | LNWPHHJWKZTELQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |