C17H19N3O2 — CID 175433531
4-isocyanato-N-[[4-(2-methylpropoxy)phenyl]methyl]pyridin-2-amine (PubChem CID 175433531) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-isocyanato-N-[[4-(2-methylpropoxy)phenyl]methyl]pyridin-2-amine.
| Compound Name | 4-isocyanato-N-[[4-(2-methylpropoxy)phenyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 175433531 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-isocyanato-N-[[4-(2-methylpropoxy)phenyl]methyl]pyridin-2-amine |
| SMILES | CC(C)COc1ccc(CNc2cc(N=C=O)ccn2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-13(2)11-22-16-5-3-14(4-6-16)10-19-17-9-15(20-12-21)7-8-18-17/h3-9,13H,10-11H2,1-2H3,(H,18,19) |
| InChIKey | WZZXOUFDTFWRKD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|