C18H13N3O4 — CID 175435635
3-[2-(2,4-dihydroxyphenyl)benzotriazol-5-yl]benzene-1,2-diol (PubChem CID 175435635) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-[2-(2,4-dihydroxyphenyl)benzotriazol-5-yl]benzene-1,2-diol.
| Compound Name | 3-[2-(2,4-dihydroxyphenyl)benzotriazol-5-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 175435635 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-[2-(2,4-dihydroxyphenyl)benzotriazol-5-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-n2nc3ccc(-c4cccc(O)c4O)cc3n2)c(O)c1 |
| InChI | InChI=1S/C18H13N3O4/c22-11-5-7-15(17(24)9-11)21-19-13-6-4-10(8-14(13)20-21)12-2-1-3-16(23)18(12)25/h1-9,22-25H |
| InChIKey | OYTIDCCSIOVVCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|