C12H15N2NaO3S — CID 175439861
sodium;hydride;1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-3-sulfinic acid (PubChem CID 175439861) has the molecular formula C12H15N2NaO3S and a molecular weight of 290.32 g/mol. Its IUPAC name is sodium;hydride;1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-3-sulfinic acid.
| Compound Name | sodium;hydride;1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-3-sulfinic acid |
|---|---|
| PubChem CID | 175439861 |
| Molecular Formula | C12H15N2NaO3S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | sodium;hydride;1-[(4-methoxyphenyl)methyl]-4-methylpyrazole-3-sulfinic acid |
| SMILES | COc1ccc(Cn2cc(C)c(S(=O)O)n2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C12H14N2O3S.Na.H/c1-9-7-14(13-12(9)18(15)16)8-10-3-5-11(17-2)6-4-10;;/h3-7H,8H2,1-2H3,(H,15,16);;/q;+1;-1 |
| InChIKey | NMGLNABFAJWGHI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|