About sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate
sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate (PubChem CID 175440197) has the molecular formula C10H8Cl2FNaO3
and a molecular weight of 289.07 g/mol. Its IUPAC name is sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate.
Molecular Properties
| Compound Name | sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate |
| PubChem CID | 175440197 |
| Molecular Formula | C10H8Cl2FNaO3 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate |
| SMILES | COC(=O)C(Cl)C(=O)c1ccc(Cl)c(F)c1.[H-].[Na+] |
| InChI | InChI=1S/C10H7Cl2FO3.Na.H/c1-16-10(15)8(12)9(14)5-2-3-6(11)7(13)4-5;;/h2-4,8H,1H3;;/q;+1;-1 |
| InChIKey | WWPCRPDORSWWBZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate?
The IUPAC name of sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate (CID 175440197) is sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate.
What is the SMILES notation for sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate?
The canonical SMILES for sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate is COC(=O)C(Cl)C(=O)c1ccc(Cl)c(F)c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate?
The InChIKey is WWPCRPDORSWWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2FO3.Na.H/c1-16-10(15)8(12)9(14)5-2-3-6(11)7(13)4-5;;/h2-4,8H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate?
sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate has a molecular weight of 289.07 g/mol, XLogP of -0.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methyl 2-chloro-3-(4-chloro-3-fluorophenyl)-3-oxopropanoate is sourced from PubChem (CID 175440197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).