C16H20N2O2 — CID 175440437
N-[(E)-6-(prop-2-enoylamino)hex-5-enyl]benzamide (PubChem CID 175440437) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[(E)-6-(prop-2-enoylamino)hex-5-enyl]benzamide.
| Compound Name | N-[(E)-6-(prop-2-enoylamino)hex-5-enyl]benzamide |
|---|---|
| PubChem CID | 175440437 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(E)-6-(prop-2-enoylamino)hex-5-enyl]benzamide |
| SMILES | C=CC(=O)N/C=C/CCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-15(19)17-12-8-3-4-9-13-18-16(20)14-10-6-5-7-11-14/h2,5-8,10-12H,1,3-4,9,13H2,(H,17,19)(H,18,20)/b12-8+ |
| InChIKey | AQOAQCKLZACLID-XYOKQWHBSA-N |
| XLogP | 2.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|