C20H19ClN6O2 — CID 175441280
1-[2-[2-[1-(4-chlorophenyl)pyrazol-3-yl]oxyethyl]-3-methylphenyl]-4-methyltetrazol-5-one (PubChem CID 175441280) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is 1-[2-[2-[1-(4-chlorophenyl)pyrazol-3-yl]oxyethyl]-3-methylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[2-[1-(4-chlorophenyl)pyrazol-3-yl]oxyethyl]-3-methylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 175441280 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-[2-[2-[1-(4-chlorophenyl)pyrazol-3-yl]oxyethyl]-3-methylphenyl]-4-methyltetrazol-5-one |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1CCOc1ccn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H19ClN6O2/c1-14-4-3-5-18(27-20(28)25(2)23-24-27)17(14)11-13-29-19-10-12-26(22-19)16-8-6-15(21)7-9-16/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | AWOTUBXXWNWBJM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |