C20H25NO3 — CID 175442129
ethyl 3-(3,4-dimethyl-2-oxo-5-phenyl-1-prop-2-enylpyrrol-3-yl)propanoate (PubChem CID 175442129) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl 3-(3,4-dimethyl-2-oxo-5-phenyl-1-prop-2-enylpyrrol-3-yl)propanoate.
| Compound Name | ethyl 3-(3,4-dimethyl-2-oxo-5-phenyl-1-prop-2-enylpyrrol-3-yl)propanoate |
|---|---|
| PubChem CID | 175442129 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | ethyl 3-(3,4-dimethyl-2-oxo-5-phenyl-1-prop-2-enylpyrrol-3-yl)propanoate |
| SMILES | C=CCN1C(=O)C(C)(CCC(=O)OCC)C(C)=C1c1ccccc1 |
| InChI | InChI=1S/C20H25NO3/c1-5-14-21-18(16-10-8-7-9-11-16)15(3)20(4,19(21)23)13-12-17(22)24-6-2/h5,7-11H,1,6,12-14H2,2-4H3 |
| InChIKey | QIWCTSWBBVARQU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|