C26H14F6N2O3 — CID 175443911
1-(pyridin-2-ylmethyl)-3-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-4-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 175443911) has the molecular formula C26H14F6N2O3 and a molecular weight of 516.40 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-3-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-4-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-(pyridin-2-ylmethyl)-3-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-4-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175443911 |
| Molecular Formula | C26H14F6N2O3 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)-3-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-4-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(C#Cc2ccc(OC(F)(F)F)cc2)=C(c2ccc(C(F)(F)F)cc2)C(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C26H14F6N2O3/c27-25(28,29)18-9-7-17(8-10-18)22-21(13-6-16-4-11-20(12-5-16)37-26(30,31)32)23(35)34(24(22)36)15-19-3-1-2-14-33-19/h1-5,7-12,14H,15H2 |
| InChIKey | BQUUMFLOKIYYFF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|