C19H22ClN3O2S — CID 175447173
1-benzylsulfonyl-3-piperidin-4-ylpyrrolo[3,2-c]pyridine;hydrochloride (PubChem CID 175447173) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is 1-benzylsulfonyl-3-piperidin-4-ylpyrrolo[3,2-c]pyridine;hydrochloride.
| Compound Name | 1-benzylsulfonyl-3-piperidin-4-ylpyrrolo[3,2-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 175447173 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 1-benzylsulfonyl-3-piperidin-4-ylpyrrolo[3,2-c]pyridine;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1)n1cc(C2CCNCC2)c2cnccc21 |
| InChI | InChI=1S/C19H21N3O2S.ClH/c23-25(24,14-15-4-2-1-3-5-15)22-13-18(16-6-9-20-10-7-16)17-12-21-11-8-19(17)22;/h1-5,8,11-13,16,20H,6-7,9-10,14H2;1H |
| InChIKey | MSXJSIFDPAONRD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |