C35H49N5O7 — CID 175449668
(6S)-6,9-diamino-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]nonanoic acid (PubChem CID 175449668) has the molecular formula C35H49N5O7 and a molecular weight of 651.80 g/mol. Its IUPAC name is (6S)-6,9-diamino-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]nonanoic acid.
| Compound Name | (6S)-6,9-diamino-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]nonanoic acid |
|---|---|
| PubChem CID | 175449668 |
| Molecular Formula | C35H49N5O7 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | (6S)-6,9-diamino-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]nonanoic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOc1ccc(-c2ccc(C(CC[C@H](N)CCCN)CC(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C35H49N5O7/c36-15-3-4-30(37)12-11-29(26-35(41)42)27-7-9-28(10-8-27)31-13-14-34(33-6-2-1-5-32(31)33)47-25-24-46-23-22-45-21-20-44-19-18-43-17-16-39-40-38/h1-2,5-10,13-14,29-30H,3-4,11-12,15-26,36-37H2,(H,41,42)/t29?,30-/m1/s1 |
| InChIKey | ONLAQSYCSMQZKZ-BDCODIICSA-N |
| XLogP | 5.67 |
| TPSA | 184.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|