C4H6O11S2 — CID 175450587
1-hydroxy-2-(2-hydroxy-2-sulfoacetyl)oxy-2-oxoethanesulfonic acid (PubChem CID 175450587) has the molecular formula C4H6O11S2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 1-hydroxy-2-(2-hydroxy-2-sulfoacetyl)oxy-2-oxoethanesulfonic acid.
| Compound Name | 1-hydroxy-2-(2-hydroxy-2-sulfoacetyl)oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 175450587 |
| Molecular Formula | C4H6O11S2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 293.94 |
| IUPAC Name | 1-hydroxy-2-(2-hydroxy-2-sulfoacetyl)oxy-2-oxoethanesulfonic acid |
| SMILES | O=C(OC(=O)C(O)S(=O)(=O)O)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C4H6O11S2/c5-1(3(7)16(9,10)11)15-2(6)4(8)17(12,13)14/h3-4,7-8H,(H,9,10,11)(H,12,13,14) |
| InChIKey | GMENTOLHWZVCKE-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|