C12H24O6S — CID 174451226
1-hydroxy-2-oxo-2-pentoxyethanesulfonic acid;pent-2-ene (PubChem CID 174451226) has the molecular formula C12H24O6S and a molecular weight of 296.38 g/mol. Its IUPAC name is 1-hydroxy-2-oxo-2-pentoxyethanesulfonic acid;pent-2-ene.
| Compound Name | 1-hydroxy-2-oxo-2-pentoxyethanesulfonic acid;pent-2-ene |
|---|---|
| PubChem CID | 174451226 |
| Molecular Formula | C12H24O6S |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-hydroxy-2-oxo-2-pentoxyethanesulfonic acid;pent-2-ene |
| SMILES | CC=CCC.CCCCCOC(=O)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C7H14O6S.C5H10/c1-2-3-4-5-13-6(8)7(9)14(10,11)12;1-3-5-4-2/h7,9H,2-5H2,1H3,(H,10,11,12);3,5H,4H2,1-2H3 |
| InChIKey | UWPMFHLCJQSNPX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|