C8H12O4Si — CID 175450764
1-silyloctane-1,2,3,4-tetrone (PubChem CID 175450764) has the molecular formula C8H12O4Si and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-silyloctane-1,2,3,4-tetrone.
| Compound Name | 1-silyloctane-1,2,3,4-tetrone |
|---|---|
| PubChem CID | 175450764 |
| Molecular Formula | C8H12O4Si |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-silyloctane-1,2,3,4-tetrone |
| SMILES | CCCCC(=O)C(=O)C(=O)C(=O)[SiH3] |
| InChI | InChI=1S/C8H12O4Si/c1-2-3-4-5(9)6(10)7(11)8(12)13/h2-4H2,1,13H3 |
| InChIKey | SNUHOQVSIXPLNN-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|