About methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate
methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 175451667) has the molecular formula C14H16BrNO2
and a molecular weight of 310.19 g/mol. Its IUPAC name is methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate |
| PubChem CID | 175451667 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | COC(=O)C1CC=C(Br)CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H16BrNO2/c1-18-14(17)13-8-7-12(15)10-16(13)9-11-5-3-2-4-6-11/h2-7,13H,8-10H2,1H3 |
| InChIKey | PTXXFXQFLVTSCS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate?
The IUPAC name of methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate (CID 175451667) is methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate.
What is the SMILES notation for methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate?
The canonical SMILES for methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate is COC(=O)C1CC=C(Br)CN1Cc1ccccc1.
What is the InChIKey of methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate?
The InChIKey is PTXXFXQFLVTSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrNO2/c1-18-14(17)13-8-7-12(15)10-16(13)9-11-5-3-2-4-6-11/h2-7,13H,8-10H2,1H3.
What are the key properties of methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate?
methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate has a molecular weight of 310.19 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzyl-5-bromo-3,6-dihydro-2H-pyridine-2-carboxylate is sourced from PubChem (CID 175451667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).