C18H45N4O6P — CID 175452034
2-aminoacetic acid;N'-[2-(dihexylamino)ethyl]ethane-1,2-diamine;phosphoric acid (PubChem CID 175452034) has the molecular formula C18H45N4O6P and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-aminoacetic acid;N'-[2-(dihexylamino)ethyl]ethane-1,2-diamine;phosphoric acid.
| Compound Name | 2-aminoacetic acid;N'-[2-(dihexylamino)ethyl]ethane-1,2-diamine;phosphoric acid |
|---|---|
| PubChem CID | 175452034 |
| Molecular Formula | C18H45N4O6P |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 2-aminoacetic acid;N'-[2-(dihexylamino)ethyl]ethane-1,2-diamine;phosphoric acid |
| SMILES | CCCCCCN(CCCCCC)CCNCCN.NCC(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C16H37N3.C2H5NO2.H3O4P/c1-3-5-7-9-14-19(15-10-8-6-4-2)16-13-18-12-11-17;3-1-2(4)5;1-5(2,3)4/h18H,3-17H2,1-2H3;1,3H2,(H,4,5);(H3,1,2,3,4) |
| InChIKey | IOYUJWADPLYGOZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|