C22H28N4O — CID 175453655
3-[1-[3-(diethylamino)propyl]benzimidazol-2-yl]-N-methylbenzamide (PubChem CID 175453655) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[1-[3-(diethylamino)propyl]benzimidazol-2-yl]-N-methylbenzamide.
| Compound Name | 3-[1-[3-(diethylamino)propyl]benzimidazol-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 175453655 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-[1-[3-(diethylamino)propyl]benzimidazol-2-yl]-N-methylbenzamide |
| SMILES | CCN(CC)CCCn1c(-c2cccc(C(=O)NC)c2)nc2ccccc21 |
| InChI | InChI=1S/C22H28N4O/c1-4-25(5-2)14-9-15-26-20-13-7-6-12-19(20)24-21(26)17-10-8-11-18(16-17)22(27)23-3/h6-8,10-13,16H,4-5,9,14-15H2,1-3H3,(H,23,27) |
| InChIKey | DELGHIXAUHHEIF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |