C29H34N6O2 — CID 73051934
3-[2-[4-[3-(diethylamino)propylcarbamoyl]anilino]benzimidazol-1-yl]-N-methylbenzamide (PubChem CID 73051934) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[2-[4-[3-(diethylamino)propylcarbamoyl]anilino]benzimidazol-1-yl]-N-methylbenzamide.
| Compound Name | 3-[2-[4-[3-(diethylamino)propylcarbamoyl]anilino]benzimidazol-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 73051934 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-[2-[4-[3-(diethylamino)propylcarbamoyl]anilino]benzimidazol-1-yl]-N-methylbenzamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccc(Nc2nc3ccccc3n2-c2cccc(C(=O)NC)c2)cc1 |
| InChI | InChI=1S/C29H34N6O2/c1-4-34(5-2)19-9-18-31-28(37)21-14-16-23(17-15-21)32-29-33-25-12-6-7-13-26(25)35(29)24-11-8-10-22(20-24)27(36)30-3/h6-8,10-17,20H,4-5,9,18-19H2,1-3H3,(H,30,36)(H,31,37)(H,32,33) |
| InChIKey | UKIVNPCRNYWOHX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|