C34H40N8O — CID 46879440
3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methyl-N-(3-methylphenyl)benzamide (PubChem CID 46879440) has the molecular formula C34H40N8O and a molecular weight of 576.75 g/mol. Its IUPAC name is 3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methyl-N-(3-methylphenyl)benzamide.
| Compound Name | 3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methyl-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 46879440 |
| Molecular Formula | C34H40N8O |
| Molecular Weight | 576.75 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methyl-N-(3-methylphenyl)benzamide |
| SMILES | CCN(CC)CCCCNc1cc(-n2c(Nc3cc(C(=O)Nc4cccc(C)c4)ccc3C)nc3ccccc32)ncn1 |
| InChI | InChI=1S/C34H40N8O/c1-5-41(6-2)19-10-9-18-35-31-22-32(37-23-36-31)42-30-15-8-7-14-28(30)39-34(42)40-29-21-26(17-16-25(29)4)33(43)38-27-13-11-12-24(3)20-27/h7-8,11-17,20-23H,5-6,9-10,18-19H2,1-4H3,(H,38,43)(H,39,40)(H,35,36,37) |
| InChIKey | MFMWEMNCORMIPH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|