C34H39FN8O — CID 71057119
N-[3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methylphenyl]-3-(fluoromethyl)benzamide (PubChem CID 71057119) has the molecular formula C34H39FN8O and a molecular weight of 594.74 g/mol. Its IUPAC name is N-[3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methylphenyl]-3-(fluoromethyl)benzamide.
| Compound Name | N-[3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methylphenyl]-3-(fluoromethyl)benzamide |
|---|---|
| PubChem CID | 71057119 |
| Molecular Formula | C34H39FN8O |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | N-[3-[[1-[6-[4-(diethylamino)butylamino]pyrimidin-4-yl]benzimidazol-2-yl]amino]-4-methylphenyl]-3-(fluoromethyl)benzamide |
| SMILES | CCN(CC)CCCCNc1cc(-n2c(Nc3cc(NC(=O)c4cccc(CF)c4)ccc3C)nc3ccccc32)ncn1 |
| InChI | InChI=1S/C34H39FN8O/c1-4-42(5-2)18-9-8-17-36-31-21-32(38-23-37-31)43-30-14-7-6-13-28(30)40-34(43)41-29-20-27(16-15-24(29)3)39-33(44)26-12-10-11-25(19-26)22-35/h6-7,10-16,19-21,23H,4-5,8-9,17-18,22H2,1-3H3,(H,39,44)(H,40,41)(H,36,37,38) |
| InChIKey | JUGYWIQYTHODLW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|