C16H22N4O2S — CID 175454278
1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]-N-prop-1-en-2-ylpiperidine-3-carboxamide (PubChem CID 175454278) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]-N-prop-1-en-2-ylpiperidine-3-carboxamide.
| Compound Name | 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]-N-prop-1-en-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 175454278 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]-N-prop-1-en-2-ylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)Nc1ncc(CN2CCCC(C(=O)NC(=C)C)C2)s1 |
| InChI | InChI=1S/C16H22N4O2S/c1-4-14(21)19-16-17-8-13(23-16)10-20-7-5-6-12(9-20)15(22)18-11(2)3/h4,8,12H,1-2,5-7,9-10H2,3H3,(H,18,22)(H,17,19,21) |
| InChIKey | WKHSZKVHYLODJY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|