C13H17N3O3S — CID 175454306
1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 175454306) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 175454306 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-[[2-(prop-2-enoylamino)-1,3-thiazol-5-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | C=CC(=O)Nc1ncc(CN2CCC(C(=O)O)CC2)s1 |
| InChI | InChI=1S/C13H17N3O3S/c1-2-11(17)15-13-14-7-10(20-13)8-16-5-3-9(4-6-16)12(18)19/h2,7,9H,1,3-6,8H2,(H,18,19)(H,14,15,17) |
| InChIKey | ZDXCXSSRLOVSBS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|